C8H6N4 — CID 58518078
3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene (PubChem CID 58518078) has the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. Its IUPAC name is 3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene.
| Compound Name | 3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
|---|---|
| PubChem CID | 58518078 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
| SMILES | c1cc2c3nncn3ccn2c1 |
| InChI | InChI=1S/C8H6N4/c1-2-7-8-10-9-6-12(8)5-4-11(7)3-1/h1-6H |
| InChIKey | OLMLCGWOLDMZCR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |