C13H10N4O — CID 138707243
2-pyridin-2-yl-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetaldehyde (PubChem CID 138707243) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-pyridin-2-yl-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetaldehyde.
| Compound Name | 2-pyridin-2-yl-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetaldehyde |
|---|---|
| PubChem CID | 138707243 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-pyridin-2-yl-2-([1,2,4]triazolo[4,3-a]pyridin-8-yl)acetaldehyde |
| SMILES | O=CC(c1ccccn1)c1cccn2cnnc12 |
| InChI | InChI=1S/C13H10N4O/c18-8-11(12-5-1-2-6-14-12)10-4-3-7-17-9-15-16-13(10)17/h1-9,11H |
| InChIKey | AJHJOZJSVGKKKT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|