C8H10BrN5 — CID 80676331
N-(2-bromoethyl)-N-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 80676331) has the molecular formula C8H10BrN5 and a molecular weight of 256.11 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(2-bromoethyl)-N-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80676331 |
| Molecular Formula | C8H10BrN5 |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | N-(2-bromoethyl)-N-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | CN(CCBr)c1nccn2cnnc12 |
| InChI | InChI=1S/C8H10BrN5/c1-13(4-2-9)7-8-12-11-6-14(8)5-3-10-7/h3,5-6H,2,4H2,1H3 |
| InChIKey | XHNLHRAHTGLDFD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|