C11H18BrN3O — CID 80676762
3-[2-bromoethyl(methyl)amino]-1-(2-methylpropyl)pyrazin-2-one (PubChem CID 80676762) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is 3-[2-bromoethyl(methyl)amino]-1-(2-methylpropyl)pyrazin-2-one.
| Compound Name | 3-[2-bromoethyl(methyl)amino]-1-(2-methylpropyl)pyrazin-2-one |
|---|---|
| PubChem CID | 80676762 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-[2-bromoethyl(methyl)amino]-1-(2-methylpropyl)pyrazin-2-one |
| SMILES | CC(C)Cn1ccnc(N(C)CCBr)c1=O |
| InChI | InChI=1S/C11H18BrN3O/c1-9(2)8-15-7-5-13-10(11(15)16)14(3)6-4-12/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | JLJBYGUQPKDBRK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|