C14H24N4OS — CID 62939107
3-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]-propan-2-ylamino]propanethioamide (PubChem CID 62939107) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]-propan-2-ylamino]propanethioamide.
| Compound Name | 3-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]-propan-2-ylamino]propanethioamide |
|---|---|
| PubChem CID | 62939107 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-[[4-(2-methylpropyl)-3-oxopyrazin-2-yl]-propan-2-ylamino]propanethioamide |
| SMILES | CC(C)Cn1ccnc(N(CCC(N)=S)C(C)C)c1=O |
| InChI | InChI=1S/C14H24N4OS/c1-10(2)9-17-8-6-16-13(14(17)19)18(11(3)4)7-5-12(15)20/h6,8,10-11H,5,7,9H2,1-4H3,(H2,15,20) |
| InChIKey | PBIFTKHFYAGDTQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|