C12H18N4O — CID 80878142
8-(3,3-dimethylbutoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80878142) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 8-(3,3-dimethylbutoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(3,3-dimethylbutoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80878142 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 8-(3,3-dimethylbutoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CC(C)(C)CCOc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C12H18N4O/c1-12(2,3)4-7-17-11-10-14-5-6-16(10)8-9(13)15-11/h5-6,8H,4,7,13H2,1-3H3 |
| InChIKey | OEOMINFBGZCRHM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |