C13H11FN4O — CID 80876110
8-[(2-fluorophenyl)methoxy]imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80876110) has the molecular formula C13H11FN4O and a molecular weight of 258.26 g/mol. Its IUPAC name is 8-[(2-fluorophenyl)methoxy]imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-[(2-fluorophenyl)methoxy]imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80876110 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 8-[(2-fluorophenyl)methoxy]imidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(OCc2ccccc2F)n1 |
| InChI | InChI=1S/C13H11FN4O/c14-10-4-2-1-3-9(10)8-19-13-12-16-5-6-18(12)7-11(15)17-13/h1-7H,8,15H2 |
| InChIKey | YUBGBDZGKYOFQV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |