C12H7BrF2N4O — CID 107102607
8-(5-bromo-2,3-difluorophenoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 107102607) has the molecular formula C12H7BrF2N4O and a molecular weight of 341.12 g/mol. Its IUPAC name is 8-(5-bromo-2,3-difluorophenoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(5-bromo-2,3-difluorophenoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 107102607 |
| Molecular Formula | C12H7BrF2N4O |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 8-(5-bromo-2,3-difluorophenoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(Oc2cc(Br)cc(F)c2F)n1 |
| InChI | InChI=1S/C12H7BrF2N4O/c13-6-3-7(14)10(15)8(4-6)20-12-11-17-1-2-19(11)5-9(16)18-12/h1-5H,16H2 |
| InChIKey | ATNDBRXGIQWLKH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|