C14H14N4O2 — CID 80880981
8-(2-methoxy-4-methylphenoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80880981) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 8-(2-methoxy-4-methylphenoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(2-methoxy-4-methylphenoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80880981 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 8-(2-methoxy-4-methylphenoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | COc1cc(C)ccc1Oc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C14H14N4O2/c1-9-3-4-10(11(7-9)19-2)20-14-13-16-5-6-18(13)8-12(15)17-14/h3-8H,15H2,1-2H3 |
| InChIKey | MRPKVEDKLPOFEF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |