C11H16N4O3 — CID 104568343
8-[2-(2-methoxyethoxy)ethoxy]imidazo[1,2-a]pyrazin-6-amine (PubChem CID 104568343) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 8-[2-(2-methoxyethoxy)ethoxy]imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-[2-(2-methoxyethoxy)ethoxy]imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 104568343 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 8-[2-(2-methoxyethoxy)ethoxy]imidazo[1,2-a]pyrazin-6-amine |
| SMILES | COCCOCCOc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C11H16N4O3/c1-16-4-5-17-6-7-18-11-10-13-2-3-15(10)8-9(12)14-11/h2-3,8H,4-7,12H2,1H3 |
| InChIKey | KRWIUTCRJPUUGB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|