C14H13FN6 — CID 154003447
N'-amino-8-[(2-fluorophenyl)methyl]imidazo[1,2-a]pyrazine-6-carboximidamide (PubChem CID 154003447) has the molecular formula C14H13FN6 and a molecular weight of 284.30 g/mol. Its IUPAC name is N'-amino-8-[(2-fluorophenyl)methyl]imidazo[1,2-a]pyrazine-6-carboximidamide.
| Compound Name | N'-amino-8-[(2-fluorophenyl)methyl]imidazo[1,2-a]pyrazine-6-carboximidamide |
|---|---|
| PubChem CID | 154003447 |
| Molecular Formula | C14H13FN6 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N'-amino-8-[(2-fluorophenyl)methyl]imidazo[1,2-a]pyrazine-6-carboximidamide |
| SMILES | NN=C(N)c1cn2ccnc2c(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C14H13FN6/c15-10-4-2-1-3-9(10)7-11-14-18-5-6-21(14)8-12(19-11)13(16)20-17/h1-6,8H,7,17H2,(H2,16,20) |
| InChIKey | AKJOCYSCPWHXLD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|