C16H13F4N6+ — CID 163958437
[1-[[amino-[8-[(3-fluorophenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]methylidene]amino]-2,2,2-trifluoroethylidene]azanium (PubChem CID 163958437) has the molecular formula C16H13F4N6+ and a molecular weight of 365.31 g/mol. Its IUPAC name is [1-[[amino-[8-[(3-fluorophenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]methylidene]amino]-2,2,2-trifluoroethylidene]azanium.
| Compound Name | [1-[[amino-[8-[(3-fluorophenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]methylidene]amino]-2,2,2-trifluoroethylidene]azanium |
|---|---|
| PubChem CID | 163958437 |
| Molecular Formula | C16H13F4N6+ |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [1-[[amino-[8-[(3-fluorophenyl)methyl]imidazo[1,2-a]pyrazin-6-yl]methylidene]amino]-2,2,2-trifluoroethylidene]azanium |
| SMILES | N/C(=N\C(=[NH2+])C(F)(F)F)c1cn2ccnc2c(Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C16H12F4N6/c17-10-3-1-2-9(6-10)7-11-14-23-4-5-26(14)8-12(24-11)13(21)25-15(22)16(18,19)20/h1-6,8H,7H2,(H3,21,22,25)/p+1 |
| InChIKey | SFKJEIIZHJJRBJ-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|