C12H14FN5O — CID 154338549
N'-amino-1-[(2-fluorophenyl)methyl]-5-methoxypyrazole-3-carboximidamide (PubChem CID 154338549) has the molecular formula C12H14FN5O and a molecular weight of 263.28 g/mol. Its IUPAC name is N'-amino-1-[(2-fluorophenyl)methyl]-5-methoxypyrazole-3-carboximidamide.
| Compound Name | N'-amino-1-[(2-fluorophenyl)methyl]-5-methoxypyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 154338549 |
| Molecular Formula | C12H14FN5O |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N'-amino-1-[(2-fluorophenyl)methyl]-5-methoxypyrazole-3-carboximidamide |
| SMILES | COc1cc(C(N)=NN)nn1Cc1ccccc1F |
| InChI | InChI=1S/C12H14FN5O/c1-19-11-6-10(12(14)16-15)17-18(11)7-8-4-2-3-5-9(8)13/h2-6H,7,15H2,1H3,(H2,14,16) |
| InChIKey | KSESYWCYKWQCTB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|