C12H7FN2O4-2 — CID 22224479
1-[(2-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate (PubChem CID 22224479) has the molecular formula C12H7FN2O4-2 and a molecular weight of 262.20 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate.
| Compound Name | 1-[(2-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22224479 |
| Molecular Formula | C12H7FN2O4-2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]pyrazole-3,5-dicarboxylate |
| SMILES | O=C([O-])c1cc(C(=O)[O-])n(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C12H9FN2O4/c13-8-4-2-1-3-7(8)6-15-10(12(18)19)5-9(14-15)11(16)17/h1-5H,6H2,(H,16,17)(H,18,19)/p-2 |
| InChIKey | CUQYSKXGRDVRLF-UHFFFAOYSA-L |
| XLogP | -1.20 |
| TPSA | 98.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |