C15H16FN5O — CID 87527800
5-[(3Z)-4-aminooxybuta-1,3-dien-2-yl]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboximidamide (PubChem CID 87527800) has the molecular formula C15H16FN5O and a molecular weight of 301.33 g/mol. Its IUPAC name is 5-[(3Z)-4-aminooxybuta-1,3-dien-2-yl]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboximidamide.
| Compound Name | 5-[(3Z)-4-aminooxybuta-1,3-dien-2-yl]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 87527800 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5-[(3Z)-4-aminooxybuta-1,3-dien-2-yl]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(=C)/C=C\ON)n(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C15H16FN5O/c1-10(6-7-22-19)14-8-13(15(17)18)20-21(14)9-11-4-2-3-5-12(11)16/h2-8H,1,9,19H2,(H3,17,18)/b7-6- |
| InChIKey | FXEQXOZWRBWKPB-SREVYHEPSA-N |
| XLogP | 1.77 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|