C15H12FN5O — CID 163980281
1-[(2-fluorophenyl)methyl]-N-methylidene-5-(1,2-oxazol-3-yl)pyrazole-3-carboximidamide (PubChem CID 163980281) has the molecular formula C15H12FN5O and a molecular weight of 297.29 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-methylidene-5-(1,2-oxazol-3-yl)pyrazole-3-carboximidamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-methylidene-5-(1,2-oxazol-3-yl)pyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 163980281 |
| Molecular Formula | C15H12FN5O |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-methylidene-5-(1,2-oxazol-3-yl)pyrazole-3-carboximidamide |
| SMILES | [H]/N=C(\N=C)c1cc(-c2ccon2)n(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C15H12FN5O/c1-18-15(17)13-8-14(12-6-7-22-20-12)21(19-13)9-10-4-2-3-5-11(10)16/h2-8,17H,1,9H2/b17-15- |
| InChIKey | SXTOFDMIJGNUHV-ICFOKQHNSA-N |
| XLogP | 2.75 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|