C19H24FN3O6 — CID 126572603
diethyl oxalate;ethyl 5-amino-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxylate (PubChem CID 126572603) has the molecular formula C19H24FN3O6 and a molecular weight of 409.41 g/mol. Its IUPAC name is diethyl oxalate;ethyl 5-amino-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxylate.
| Compound Name | diethyl oxalate;ethyl 5-amino-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 126572603 |
| Molecular Formula | C19H24FN3O6 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | diethyl oxalate;ethyl 5-amino-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C(=O)OCC.CCOC(=O)c1cc(N)n(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C13H14FN3O2.C6H10O4/c1-2-19-13(18)11-7-12(15)17(16-11)8-9-5-3-4-6-10(9)14;1-3-9-5(7)6(8)10-4-2/h3-7H,2,8,15H2,1H3;3-4H2,1-2H3 |
| InChIKey | QEVSOIYAMCIECZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|