C21H18F2N6O2 — CID 175080033
ethyl 2-[4,6-diamino-7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidine-5-carboxylate (PubChem CID 175080033) has the molecular formula C21H18F2N6O2 and a molecular weight of 424.41 g/mol. Its IUPAC name is ethyl 2-[4,6-diamino-7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[4,6-diamino-7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 175080033 |
| Molecular Formula | C21H18F2N6O2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | ethyl 2-[4,6-diamino-7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2nn(Cc3ccccc3F)c3c(F)c(N)cc(N)c23)nc1 |
| InChI | InChI=1S/C21H18F2N6O2/c1-2-31-21(30)12-8-26-20(27-9-12)18-16-14(24)7-15(25)17(23)19(16)29(28-18)10-11-5-3-4-6-13(11)22/h3-9H,2,10,24-25H2,1H3 |
| InChIKey | HKCLWXPASKUNRV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|