C17H22FN3O2 — CID 142142033
ethyl 5-amino-1-[(2-fluorophenyl)methyl]-4-methylpyrazole-3-carboxylate;prop-1-ene (PubChem CID 142142033) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is ethyl 5-amino-1-[(2-fluorophenyl)methyl]-4-methylpyrazole-3-carboxylate;prop-1-ene.
| Compound Name | ethyl 5-amino-1-[(2-fluorophenyl)methyl]-4-methylpyrazole-3-carboxylate;prop-1-ene |
|---|---|
| PubChem CID | 142142033 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | ethyl 5-amino-1-[(2-fluorophenyl)methyl]-4-methylpyrazole-3-carboxylate;prop-1-ene |
| SMILES | C=CC.CCOC(=O)c1nn(Cc2ccccc2F)c(N)c1C |
| InChI | InChI=1S/C14H16FN3O2.C3H6/c1-3-20-14(19)12-9(2)13(16)18(17-12)8-10-6-4-5-7-11(10)15;1-3-2/h4-7H,3,8,16H2,1-2H3;3H,1H2,2H3 |
| InChIKey | OREDLBNHYYTSHJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|