C12H11N3O2S — CID 121015772
6-(1,3-benzodioxol-5-ylmethylsulfanyl)pyridazin-3-amine (PubChem CID 121015772) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylsulfanyl)pyridazin-3-amine.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylsulfanyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 121015772 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylsulfanyl)pyridazin-3-amine |
| SMILES | Nc1ccc(SCc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C12H11N3O2S/c13-11-3-4-12(15-14-11)18-6-8-1-2-9-10(5-8)17-7-16-9/h1-5H,6-7H2,(H2,13,14) |
| InChIKey | QQMALHCUVBSIAD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |