C13H12ClF3N4 — CID 106767240
1-N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 106767240) has the molecular formula C13H12ClF3N4 and a molecular weight of 316.71 g/mol. Its IUPAC name is 1-N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 106767240 |
| Molecular Formula | C13H12ClF3N4 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-N-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2cc(Cl)nc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C13H12ClF3N4/c1-21(2)9-5-3-8(4-6-9)18-11-7-10(14)19-12(20-11)13(15,16)17/h3-7H,1-2H3,(H,18,19,20) |
| InChIKey | PWDVEYDGSAQICX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|