C17H13ClF3N5 — CID 112961112
5-N-[2-(3-chlorophenyl)ethyl]-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112961112) has the molecular formula C17H13ClF3N5 and a molecular weight of 379.77 g/mol. Its IUPAC name is 5-N-[2-(3-chlorophenyl)ethyl]-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[2-(3-chlorophenyl)ethyl]-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112961112 |
| Molecular Formula | C17H13ClF3N5 |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 5-N-[2-(3-chlorophenyl)ethyl]-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Fc1ccc(Nc2nncc(NCCc3cccc(Cl)c3)n2)c(F)c1F |
| InChI | InChI=1S/C17H13ClF3N5/c18-11-3-1-2-10(8-11)6-7-22-14-9-23-26-17(25-14)24-13-5-4-12(19)15(20)16(13)21/h1-5,8-9H,6-7H2,(H2,22,24,25,26) |
| InChIKey | KYMIXVIKAUTZBF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|