C18H17F2N5 — CID 112964941
3-N-(2,4-difluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112964941) has the molecular formula C18H17F2N5 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-N-(2,4-difluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,4-difluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112964941 |
| Molecular Formula | C18H17F2N5 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-N-(2,4-difluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1cc(C)c(Nc2cnnc(Nc3ccc(F)cc3F)n2)c(C)c1 |
| InChI | InChI=1S/C18H17F2N5/c1-10-6-11(2)17(12(3)7-10)23-16-9-21-25-18(24-16)22-15-5-4-13(19)8-14(15)20/h4-9H,1-3H3,(H2,22,23,24,25) |
| InChIKey | MKJVAMLOQWJDJL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |