C15H9F4N5 — CID 112969398
3-N,5-N-bis(2,4-difluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112969398) has the molecular formula C15H9F4N5 and a molecular weight of 335.26 g/mol. Its IUPAC name is 3-N,5-N-bis(2,4-difluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N,5-N-bis(2,4-difluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112969398 |
| Molecular Formula | C15H9F4N5 |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-N,5-N-bis(2,4-difluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Fc1ccc(Nc2cnnc(Nc3ccc(F)cc3F)n2)c(F)c1 |
| InChI | InChI=1S/C15H9F4N5/c16-8-1-3-12(10(18)5-8)21-14-7-20-24-15(23-14)22-13-4-2-9(17)6-11(13)19/h1-7H,(H2,21,22,23,24) |
| InChIKey | QDMZQVRYTQHFTD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |