C15H20N6O2S — CID 112954913
3-N-[4-(dimethylamino)phenyl]-5-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine (PubChem CID 112954913) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-N-[4-(dimethylamino)phenyl]-5-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-(dimethylamino)phenyl]-5-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112954913 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-N-[4-(dimethylamino)phenyl]-5-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine |
| SMILES | CN(C)c1ccc(Nc2nncc(NC3CCS(=O)(=O)C3)n2)cc1 |
| InChI | InChI=1S/C15H20N6O2S/c1-21(2)13-5-3-11(4-6-13)18-15-19-14(9-16-20-15)17-12-7-8-24(22,23)10-12/h3-6,9,12H,7-8,10H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | IPUOKFZMXCCQKB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|