C17H24N6O2S — CID 112955047
5-N-[4-(diethylamino)phenyl]-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine (PubChem CID 112955047) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is 5-N-[4-(diethylamino)phenyl]-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[4-(diethylamino)phenyl]-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112955047 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-N-[4-(diethylamino)phenyl]-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(CC)c1ccc(Nc2cnnc(NC3CCS(=O)(=O)C3)n2)cc1 |
| InChI | InChI=1S/C17H24N6O2S/c1-3-23(4-2)15-7-5-13(6-8-15)19-16-11-18-22-17(21-16)20-14-9-10-26(24,25)12-14/h5-8,11,14H,3-4,9-10,12H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | KKTJKBAMKUOJEF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|