C21H24N6O — CID 112968441
1-[4-[[5-[4-(diethylamino)anilino]-1,2,4-triazin-3-yl]amino]phenyl]ethanone (PubChem CID 112968441) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[4-[[5-[4-(diethylamino)anilino]-1,2,4-triazin-3-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[5-[4-(diethylamino)anilino]-1,2,4-triazin-3-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112968441 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-[4-[[5-[4-(diethylamino)anilino]-1,2,4-triazin-3-yl]amino]phenyl]ethanone |
| SMILES | CCN(CC)c1ccc(Nc2cnnc(Nc3ccc(C(C)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-4-27(5-2)19-12-10-17(11-13-19)23-20-14-22-26-21(25-20)24-18-8-6-16(7-9-18)15(3)28/h6-14H,4-5H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | DLPUFIVWHUYMML-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|