C19H20ClFN6 — CID 112966687
3-N-(3-chloro-4-fluorophenyl)-5-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112966687) has the molecular formula C19H20ClFN6 and a molecular weight of 386.86 g/mol. Its IUPAC name is 3-N-(3-chloro-4-fluorophenyl)-5-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(3-chloro-4-fluorophenyl)-5-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112966687 |
| Molecular Formula | C19H20ClFN6 |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-N-(3-chloro-4-fluorophenyl)-5-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(CC)c1ccc(Nc2cnnc(Nc3ccc(F)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C19H20ClFN6/c1-3-27(4-2)15-8-5-13(6-9-15)23-18-12-22-26-19(25-18)24-14-7-10-17(21)16(20)11-14/h5-12H,3-4H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | NGWFQCCNIVIEHW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|