C21H25ClN6 — CID 112956177
5-N-[2-(4-chlorophenyl)ethyl]-3-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112956177) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is 5-N-[2-(4-chlorophenyl)ethyl]-3-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[2-(4-chlorophenyl)ethyl]-3-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112956177 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 5-N-[2-(4-chlorophenyl)ethyl]-3-N-[4-(diethylamino)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nncc(NCCc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C21H25ClN6/c1-3-28(4-2)19-11-9-18(10-12-19)25-21-26-20(15-24-27-21)23-14-13-16-5-7-17(22)8-6-16/h5-12,15H,3-4,13-14H2,1-2H3,(H2,23,25,26,27) |
| InChIKey | CDZAIIITKRBQGK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|