C17H16ClN5 — CID 112964162
3-N-(4-chlorophenyl)-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112964162) has the molecular formula C17H16ClN5 and a molecular weight of 325.80 g/mol. Its IUPAC name is 3-N-(4-chlorophenyl)-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(4-chlorophenyl)-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112964162 |
| Molecular Formula | C17H16ClN5 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-N-(4-chlorophenyl)-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCc1ccc(Nc2cnnc(Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C17H16ClN5/c1-2-12-3-7-14(8-4-12)20-16-11-19-23-17(22-16)21-15-9-5-13(18)6-10-15/h3-11H,2H2,1H3,(H2,20,21,22,23) |
| InChIKey | AMBHEMRCKTVKQO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |