C15H21N5 — CID 112940945
3-N-butan-2-yl-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112940945) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 3-N-butan-2-yl-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-butan-2-yl-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112940945 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 3-N-butan-2-yl-5-N-(4-ethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCc1ccc(Nc2cnnc(NC(C)CC)n2)cc1 |
| InChI | InChI=1S/C15H21N5/c1-4-11(3)17-15-19-14(10-16-20-15)18-13-8-6-12(5-2)7-9-13/h6-11H,4-5H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | DKQVPPHSNXIUSL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |