C13H16ClN5 — CID 112940958
3-N-butan-2-yl-5-N-(3-chlorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112940958) has the molecular formula C13H16ClN5 and a molecular weight of 277.76 g/mol. Its IUPAC name is 3-N-butan-2-yl-5-N-(3-chlorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-butan-2-yl-5-N-(3-chlorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112940958 |
| Molecular Formula | C13H16ClN5 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-N-butan-2-yl-5-N-(3-chlorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCC(C)Nc1nncc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C13H16ClN5/c1-3-9(2)16-13-18-12(8-15-19-13)17-11-6-4-5-10(14)7-11/h4-9H,3H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | VFJNKBIGZRUVOE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |