C16H21N5O2S — CID 112954871
5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112954871) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112954871 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1cc(C)c(Nc2nncc(NC3CCS(=O)(=O)C3)n2)c(C)c1 |
| InChI | InChI=1S/C16H21N5O2S/c1-10-6-11(2)15(12(3)7-10)20-16-19-14(8-17-21-16)18-13-4-5-24(22,23)9-13/h6-8,13H,4-5,9H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | PFLBOMQKUJBGDU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |