C17H22ClN5O2S — CID 112956738
3-N-(2-chloro-4,6-dimethylphenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine (PubChem CID 112956738) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is 3-N-(2-chloro-4,6-dimethylphenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2-chloro-4,6-dimethylphenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112956738 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-N-(2-chloro-4,6-dimethylphenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(c1cnnc(Nc2c(C)cc(C)cc2Cl)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22ClN5O2S/c1-4-23(13-5-6-26(24,25)10-13)15-9-19-22-17(20-15)21-16-12(3)7-11(2)8-14(16)18/h7-9,13H,4-6,10H2,1-3H3,(H,20,21,22) |
| InChIKey | KFYHWCLNCCZXGU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |