C17H21N5O4S — CID 112951448
3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine (PubChem CID 112951448) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112951448 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(c1cnnc(NCc2ccc3c(c2)OCO3)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21N5O4S/c1-2-22(13-5-6-27(23,24)10-13)16-9-19-21-17(20-16)18-8-12-3-4-14-15(7-12)26-11-25-14/h3-4,7,9,13H,2,5-6,8,10-11H2,1H3,(H,18,20,21) |
| InChIKey | VVEOJJSCRDNZQT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |