C14H15Cl2N5O2S — CID 112955184
3-N-(2,5-dichlorophenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-methyl-1,2,4-triazine-3,5-diamine (PubChem CID 112955184) has the molecular formula C14H15Cl2N5O2S and a molecular weight of 388.28 g/mol. Its IUPAC name is 3-N-(2,5-dichlorophenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-methyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,5-dichlorophenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-methyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112955184 |
| Molecular Formula | C14H15Cl2N5O2S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 3-N-(2,5-dichlorophenyl)-5-N-(1,1-dioxothiolan-3-yl)-5-N-methyl-1,2,4-triazine-3,5-diamine |
| SMILES | CN(c1cnnc(Nc2cc(Cl)ccc2Cl)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15Cl2N5O2S/c1-21(10-4-5-24(22,23)8-10)13-7-17-20-14(19-13)18-12-6-9(15)2-3-11(12)16/h2-3,6-7,10H,4-5,8H2,1H3,(H,18,19,20) |
| InChIKey | MIWJUNNDUOJQMA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |