C12H15F2N3O — CID 136555200
N-[4-(difluoromethyl)cyclohexyl]pyridazine-3-carboxamide (PubChem CID 136555200) has the molecular formula C12H15F2N3O and a molecular weight of 255.27 g/mol. Its IUPAC name is N-[4-(difluoromethyl)cyclohexyl]pyridazine-3-carboxamide.
| Compound Name | N-[4-(difluoromethyl)cyclohexyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 136555200 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-[4-(difluoromethyl)cyclohexyl]pyridazine-3-carboxamide |
| SMILES | O=C(NC1CCC(C(F)F)CC1)c1cccnn1 |
| InChI | InChI=1S/C12H15F2N3O/c13-11(14)8-3-5-9(6-4-8)16-12(18)10-2-1-7-15-17-10/h1-2,7-9,11H,3-6H2,(H,16,18) |
| InChIKey | GFXGPQDJVWSIMU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |