C17H20N4O3S — CID 109309228
2-(3,5-dimethylanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide (PubChem CID 109309228) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-(3,5-dimethylanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109309228 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-(3,5-dimethylanilino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2nccc(C(=O)NC3CCS(=O)(=O)C3)n2)c1 |
| InChI | InChI=1S/C17H20N4O3S/c1-11-7-12(2)9-14(8-11)20-17-18-5-3-15(21-17)16(22)19-13-4-6-25(23,24)10-13/h3,5,7-9,13H,4,6,10H2,1-2H3,(H,19,22)(H,18,20,21) |
| InChIKey | HAXPTTXKPFPLGE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |