C16H24N4O3S — CID 109309208
2-(cycloheptylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide (PubChem CID 109309208) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-(cycloheptylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-(cycloheptylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109309208 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-(cycloheptylamino)-N-(1,1-dioxothiolan-3-yl)pyrimidine-4-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccnc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C16H24N4O3S/c21-15(18-13-8-10-24(22,23)11-13)14-7-9-17-16(20-14)19-12-5-3-1-2-4-6-12/h7,9,12-13H,1-6,8,10-11H2,(H,18,21)(H,17,19,20) |
| InChIKey | YUORSCOFYAVZRY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |