C14H21N3O3S — CID 109181435
N-butan-2-yl-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide (PubChem CID 109181435) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-butan-2-yl-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide.
| Compound Name | N-butan-2-yl-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109181435 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-butan-2-yl-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C14H21N3O3S/c1-3-10(2)16-14(18)13-5-4-11(8-15-13)17-12-6-7-21(19,20)9-12/h4-5,8,10,12,17H,3,6-7,9H2,1-2H3,(H,16,18) |
| InChIKey | WGWANLBKLAZUEL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |