C14H21N3O3S — CID 109193128
5-[(1,1-dioxothiolan-3-yl)amino]-N,N-diethylpyridine-2-carboxamide (PubChem CID 109193128) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)amino]-N,N-diethylpyridine-2-carboxamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)amino]-N,N-diethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109193128 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)amino]-N,N-diethylpyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C14H21N3O3S/c1-3-17(4-2)14(18)13-6-5-11(9-15-13)16-12-7-8-21(19,20)10-12/h5-6,9,12,16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | MCKMSAPFYPUJBF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |