C15H17FN2O4S — CID 108978006
1-N-(1,1-dioxothiolan-3-yl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108978006) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108978006 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1cccc(F)c1)C1(C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H17FN2O4S/c16-10-2-1-3-11(8-10)17-13(19)15(5-6-15)14(20)18-12-4-7-23(21,22)9-12/h1-3,8,12H,4-7,9H2,(H,17,19)(H,18,20) |
| InChIKey | RVAQWBUXKSXPNI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|