C14H19N3O4S2 — CID 102566476
ethyl N-[4-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]carbamate (PubChem CID 102566476) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is ethyl N-[4-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 102566476 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | ethyl N-[4-[(1,1-dioxothiolan-3-yl)carbamothioylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC(=S)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-2-21-14(18)17-11-5-3-10(4-6-11)15-13(22)16-12-7-8-23(19,20)9-12/h3-6,12H,2,7-9H2,1H3,(H,17,18)(H2,15,16,22) |
| InChIKey | CAWMVYDDLHEAAR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|