C18H20N2O3S — CID 111490932
N-[(2-hydroxycyclopentyl)methyl]-N'-(3-thiophen-2-ylphenyl)oxamide (PubChem CID 111490932) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[(2-hydroxycyclopentyl)methyl]-N'-(3-thiophen-2-ylphenyl)oxamide.
| Compound Name | N-[(2-hydroxycyclopentyl)methyl]-N'-(3-thiophen-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 111490932 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[(2-hydroxycyclopentyl)methyl]-N'-(3-thiophen-2-ylphenyl)oxamide |
| SMILES | O=C(NCC1CCCC1O)C(=O)Nc1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C18H20N2O3S/c21-15-7-2-5-13(15)11-19-17(22)18(23)20-14-6-1-4-12(10-14)16-8-3-9-24-16/h1,3-4,6,8-10,13,15,21H,2,5,7,11H2,(H,19,22)(H,20,23) |
| InChIKey | DFWGFJRFOOXRJC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|