C27H37N5O3 — CID 134108651
N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 134108651) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134108651 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | COc1cccc(N2CCN(/C(=N\CC3CCCC(CN)C3)Nc3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C27H37N5O3/c1-33-24-7-3-6-23(16-24)31-10-12-32(13-11-31)27(29-18-21-5-2-4-20(14-21)17-28)30-22-8-9-25-26(15-22)35-19-34-25/h3,6-9,15-16,20-21H,2,4-5,10-14,17-19,28H2,1H3,(H,29,30) |
| InChIKey | HIXWBCDLYBMXMM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|