C20H21N3O4 — CID 113114155
4-(3-acetylphenyl)-N-(1,3-benzodioxol-5-yl)piperazine-1-carboxamide (PubChem CID 113114155) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-(3-acetylphenyl)-N-(1,3-benzodioxol-5-yl)piperazine-1-carboxamide.
| Compound Name | 4-(3-acetylphenyl)-N-(1,3-benzodioxol-5-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113114155 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-(3-acetylphenyl)-N-(1,3-benzodioxol-5-yl)piperazine-1-carboxamide |
| SMILES | CC(=O)c1cccc(N2CCN(C(=O)Nc3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-14(24)15-3-2-4-17(11-15)22-7-9-23(10-8-22)20(25)21-16-5-6-18-19(12-16)27-13-26-18/h2-6,11-12H,7-10,13H2,1H3,(H,21,25) |
| InChIKey | TZKVGIPXFSHZHQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |