C9H14N2S — CID 63248055
2-methyl-N'-(thiophen-3-ylmethyl)propanimidamide (PubChem CID 63248055) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 2-methyl-N'-(thiophen-3-ylmethyl)propanimidamide.
| Compound Name | 2-methyl-N'-(thiophen-3-ylmethyl)propanimidamide |
|---|---|
| PubChem CID | 63248055 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-methyl-N'-(thiophen-3-ylmethyl)propanimidamide |
| SMILES | CC(C)/C(N)=N\Cc1ccsc1 |
| InChI | InChI=1S/C9H14N2S/c1-7(2)9(10)11-5-8-3-4-12-6-8/h3-4,6-7H,5H2,1-2H3,(H2,10,11) |
| InChIKey | MKHQDKUNAYKYHZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|