C12H14BrF2N3 — CID 122095501
2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclobutylguanidine (PubChem CID 122095501) has the molecular formula C12H14BrF2N3 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclobutylguanidine.
| Compound Name | 2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclobutylguanidine |
|---|---|
| PubChem CID | 122095501 |
| Molecular Formula | C12H14BrF2N3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclobutylguanidine |
| SMILES | N/C(=N\Cc1c(F)cc(Br)cc1F)NC1CCC1 |
| InChI | InChI=1S/C12H14BrF2N3/c13-7-4-10(14)9(11(15)5-7)6-17-12(16)18-8-2-1-3-8/h4-5,8H,1-3,6H2,(H3,16,17,18) |
| InChIKey | FVMRFFHYPOXGTA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|