C17H20FIN4O — CID 119954360
1-(2,3-dihydro-1H-inden-5-yl)-2-[2-[(3-fluoro-2-pyridinyl)oxy]ethyl]guanidine;hydroiodide (PubChem CID 119954360) has the molecular formula C17H20FIN4O and a molecular weight of 442.28 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-[(3-fluoro-2-pyridinyl)oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-[(3-fluoro-2-pyridinyl)oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119954360 |
| Molecular Formula | C17H20FIN4O |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-[(3-fluoro-2-pyridinyl)oxy]ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCOc1ncccc1F)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H19FN4O.HI/c18-15-5-2-8-20-16(15)23-10-9-21-17(19)22-14-7-6-12-3-1-4-13(12)11-14;/h2,5-8,11H,1,3-4,9-10H2,(H3,19,21,22);1H |
| InChIKey | KTRIAONZNSUCAR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|