C18H20FN3O — CID 111058156
1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine (PubChem CID 111058156) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111058156 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine |
| SMILES | N/C(=N\CC(O)c1ccccc1F)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H20FN3O/c19-16-7-2-1-6-15(16)17(23)11-21-18(20)22-14-9-8-12-4-3-5-13(12)10-14/h1-2,6-10,17,23H,3-5,11H2,(H3,20,21,22) |
| InChIKey | RTDZTJVSHWQJHM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|